C11H11N7O2S — CID 104850425
5-amino-N-(2H-tetrazol-5-ylmethyl)quinoline-8-sulfonamide (PubChem CID 104850425) has the molecular formula C11H11N7O2S and a molecular weight of 305.32 g/mol. Its IUPAC name is 5-amino-N-(2H-tetrazol-5-ylmethyl)quinoline-8-sulfonamide.
| Compound Name | 5-amino-N-(2H-tetrazol-5-ylmethyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 104850425 |
| Molecular Formula | C11H11N7O2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-amino-N-(2H-tetrazol-5-ylmethyl)quinoline-8-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCc2nn[nH]n2)c2ncccc12 |
| InChI | InChI=1S/C11H11N7O2S/c12-8-3-4-9(11-7(8)2-1-5-13-11)21(19,20)14-6-10-15-17-18-16-10/h1-5,14H,6,12H2,(H,15,16,17,18) |
| InChIKey | JBSULPLKZPSIIS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|