C9H12N6O3S — CID 81438010
4-amino-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 81438010) has the molecular formula C9H12N6O3S and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81438010 |
| Molecular Formula | C9H12N6O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-amino-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCc2nn[nH]n2)ccc1N |
| InChI | InChI=1S/C9H12N6O3S/c1-18-8-4-6(2-3-7(8)10)19(16,17)11-5-9-12-14-15-13-9/h2-4,11H,5,10H2,1H3,(H,12,13,14,15) |
| InChIKey | AALUKPWXZPQTLR-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|