C11H19N3O5S2 — CID 106333246
4-amino-N-[3-(methanesulfonamido)propyl]-3-methoxybenzenesulfonamide (PubChem CID 106333246) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-amino-N-[3-(methanesulfonamido)propyl]-3-methoxybenzenesulfonamide.
| Compound Name | 4-amino-N-[3-(methanesulfonamido)propyl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106333246 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-amino-N-[3-(methanesulfonamido)propyl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCCCNS(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C11H19N3O5S2/c1-19-11-8-9(4-5-10(11)12)21(17,18)14-7-3-6-13-20(2,15)16/h4-5,8,13-14H,3,6-7,12H2,1-2H3 |
| InChIKey | PGAJSVCBCRCDBM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|