C8H9FN6O2S — CID 82843953
4-amino-3-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 82843953) has the molecular formula C8H9FN6O2S and a molecular weight of 272.27 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-3-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82843953 |
| Molecular Formula | C8H9FN6O2S |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-amino-3-fluoro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCc2nn[nH]n2)cc1F |
| InChI | InChI=1S/C8H9FN6O2S/c9-6-3-5(1-2-7(6)10)18(16,17)11-4-8-12-14-15-13-8/h1-3,11H,4,10H2,(H,12,13,14,15) |
| InChIKey | CBWUAUXAPQEOIH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|