C10H14N6O2S — CID 62157363
4-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 62157363) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62157363 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C10H14N6O2S/c1-2-11-8-3-5-9(6-4-8)19(17,18)12-7-10-13-15-16-14-10/h3-6,11-12H,2,7H2,1H3,(H,13,14,15,16) |
| InChIKey | LOMYAFRWUAACAP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |