C12H15N3O3S — CID 106422766
4-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide (PubChem CID 106422766) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106422766 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NCc2ccno2)cc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-13-10-3-5-12(6-4-10)19(16,17)15-9-11-7-8-14-18-11/h3-8,13,15H,2,9H2,1H3 |
| InChIKey | YSRMIXIUKLPNEY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |