C11H14N4O3S — CID 106422783
2-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)pyridine-3-sulfonamide (PubChem CID 106422783) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106422783 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(ethylamino)-N-(1,2-oxazol-5-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncccc1S(=O)(=O)NCc1ccno1 |
| InChI | InChI=1S/C11H14N4O3S/c1-2-12-11-10(4-3-6-13-11)19(16,17)15-8-9-5-7-14-18-9/h3-7,15H,2,8H2,1H3,(H,12,13) |
| InChIKey | NIACSOPJCKFKCB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |