C12H17N5O2S — CID 82875234
2-(ethylamino)-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 82875234) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-(ethylamino)-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-(ethylamino)-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 82875234 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(ethylamino)-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ncccc1S(=O)(=O)NCc1ccn(C)n1 |
| InChI | InChI=1S/C12H17N5O2S/c1-3-13-12-11(5-4-7-14-12)20(18,19)15-9-10-6-8-17(2)16-10/h4-8,15H,3,9H2,1-2H3,(H,13,14) |
| InChIKey | LSHDDONWCGHGGR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |