C10H13N5O2S — CID 82882628
2-amino-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 82882628) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-amino-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 82882628 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-amino-N-[(1-methylpyrazol-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cn1ccc(CNS(=O)(=O)c2cccnc2N)n1 |
| InChI | InChI=1S/C10H13N5O2S/c1-15-6-4-8(14-15)7-13-18(16,17)9-3-2-5-12-10(9)11/h2-6,13H,7H2,1H3,(H2,11,12) |
| InChIKey | RXBUKDQGSQPEMM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |