C11H13FN4O2S — CID 82882897
5-amino-2-fluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide (PubChem CID 82882897) has the molecular formula C11H13FN4O2S and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82882897 |
| Molecular Formula | C11H13FN4O2S |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-amino-2-fluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccc(CNS(=O)(=O)c2cc(N)ccc2F)n1 |
| InChI | InChI=1S/C11H13FN4O2S/c1-16-5-4-9(15-16)7-14-19(17,18)11-6-8(13)2-3-10(11)12/h2-6,14H,7,13H2,1H3 |
| InChIKey | BVOXIFZHDIICPI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|