C12H14F2N4O2S — CID 106103901
3-amino-2,4-difluoro-N-[2-(1-methylpyrazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 106103901) has the molecular formula C12H14F2N4O2S and a molecular weight of 316.33 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-[2-(1-methylpyrazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-[2-(1-methylpyrazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106103901 |
| Molecular Formula | C12H14F2N4O2S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-amino-2,4-difluoro-N-[2-(1-methylpyrazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1ccc(CCNS(=O)(=O)c2ccc(F)c(N)c2F)n1 |
| InChI | InChI=1S/C12H14F2N4O2S/c1-18-7-5-8(17-18)4-6-16-21(19,20)10-3-2-9(13)12(15)11(10)14/h2-3,5,7,16H,4,6,15H2,1H3 |
| InChIKey | SVTMPEQDRIBBJG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|