C11H11F2N3O2S — CID 22207747
2,5-difluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide (PubChem CID 22207747) has the molecular formula C11H11F2N3O2S and a molecular weight of 287.29 g/mol. Its IUPAC name is 2,5-difluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22207747 |
| Molecular Formula | C11H11F2N3O2S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2,5-difluoro-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccc(CNS(=O)(=O)c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C11H11F2N3O2S/c1-16-5-4-9(15-16)7-14-19(17,18)11-6-8(12)2-3-10(11)13/h2-6,14H,7H2,1H3 |
| InChIKey | AHLSKMCBFFLDOR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |