C9H13N7O2S — CID 103305294
3-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide (PubChem CID 103305294) has the molecular formula C9H13N7O2S and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide.
| Compound Name | 3-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305294 |
| Molecular Formula | C9H13N7O2S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-(ethylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C9H13N7O2S/c1-2-10-7-4-3-5-11-9(7)19(17,18)12-6-8-13-15-16-14-8/h3-5,10,12H,2,6H2,1H3,(H,13,14,15,16) |
| InChIKey | SVAOCQSKFSXCIK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |