C10H17N3O2S2 — CID 103306115
3-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-2-sulfonamide (PubChem CID 103306115) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-2-sulfonamide.
| Compound Name | 3-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103306115 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)NCCSC |
| InChI | InChI=1S/C10H17N3O2S2/c1-3-11-9-5-4-6-12-10(9)17(14,15)13-7-8-16-2/h4-6,11,13H,3,7-8H2,1-2H3 |
| InChIKey | BBKCBEFNCMVVFX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|