C14H17N3O2S2 — CID 107642917
3-(ethylamino)-N-(2-methylsulfanylphenyl)pyridine-2-sulfonamide (PubChem CID 107642917) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-(ethylamino)-N-(2-methylsulfanylphenyl)pyridine-2-sulfonamide.
| Compound Name | 3-(ethylamino)-N-(2-methylsulfanylphenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 107642917 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-(ethylamino)-N-(2-methylsulfanylphenyl)pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C14H17N3O2S2/c1-3-15-12-8-6-10-16-14(12)21(18,19)17-11-7-4-5-9-13(11)20-2/h4-10,15,17H,3H2,1-2H3 |
| InChIKey | PZXLYBQHPRSQMB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |