C13H13F2N3O2S — CID 103304014
N-(2,4-difluorophenyl)-3-(ethylamino)pyridine-2-sulfonamide (PubChem CID 103304014) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(ethylamino)pyridine-2-sulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(ethylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103304014 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(ethylamino)pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2N3O2S/c1-2-16-12-4-3-7-17-13(12)21(19,20)18-11-6-5-9(14)8-10(11)15/h3-8,16,18H,2H2,1H3 |
| InChIKey | MGPYDURATUOGGF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |