C11H16N6O2S — CID 103307155
3-(ethylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-2-sulfonamide (PubChem CID 103307155) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-(ethylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-2-sulfonamide.
| Compound Name | 3-(ethylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103307155 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-(ethylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C11H16N6O2S/c1-2-12-10-4-3-5-13-11(10)20(18,19)15-7-9-17-8-6-14-16-17/h3-6,8,12,15H,2,7,9H2,1H3 |
| InChIKey | UXMVJCISMQATJD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |