C11H16N6O2S — CID 106504713
3-amino-2,5,6-trimethyl-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 106504713) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-amino-2,5,6-trimethyl-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-2,5,6-trimethyl-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106504713 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-amino-2,5,6-trimethyl-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NCc2nn[nH]n2)c1C |
| InChI | InChI=1S/C11H16N6O2S/c1-6-4-9(12)8(3)11(7(6)2)20(18,19)13-5-10-14-16-17-15-10/h4,13H,5,12H2,1-3H3,(H,14,15,16,17) |
| InChIKey | LWVDOQVFCVJJSQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|