C12H20N4O3S — CID 106505300
2-[(3-amino-2,5,6-trimethylphenyl)sulfonylamino]ethylurea (PubChem CID 106505300) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(3-amino-2,5,6-trimethylphenyl)sulfonylamino]ethylurea.
| Compound Name | 2-[(3-amino-2,5,6-trimethylphenyl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 106505300 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[(3-amino-2,5,6-trimethylphenyl)sulfonylamino]ethylurea |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NCCNC(N)=O)c1C |
| InChI | InChI=1S/C12H20N4O3S/c1-7-6-10(13)9(3)11(8(7)2)20(18,19)16-5-4-15-12(14)17/h6,16H,4-5,13H2,1-3H3,(H3,14,15,17) |
| InChIKey | YJXKGHAMUSEUDT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|