C15H25N3O4S — CID 104932785
tert-butyl N-[2-[(3-amino-2,6-dimethylphenyl)sulfonylamino]ethyl]carbamate (PubChem CID 104932785) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-amino-2,6-dimethylphenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-amino-2,6-dimethylphenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 104932785 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | tert-butyl N-[2-[(3-amino-2,6-dimethylphenyl)sulfonylamino]ethyl]carbamate |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O4S/c1-10-6-7-12(16)11(2)13(10)23(20,21)18-9-8-17-14(19)22-15(3,4)5/h6-7,18H,8-9,16H2,1-5H3,(H,17,19) |
| InChIKey | AKVXAEZFSUZCID-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|