C11H16F2N2O3S — CID 106165818
3-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 106165818) has the molecular formula C11H16F2N2O3S and a molecular weight of 294.32 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106165818 |
| Molecular Formula | C11H16F2N2O3S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H16F2N2O3S/c1-7-3-4-9(14)8(2)10(7)19(17,18)15-5-11(12,13)6-16/h3-4,15-16H,5-6,14H2,1-2H3 |
| InChIKey | QZEZADWDGVSMHX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|