C11H18N2O4S — CID 66168995
2-amino-N-(2,3-dihydroxy-2-methylpropyl)-6-methylbenzenesulfonamide (PubChem CID 66168995) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-6-methylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66168995 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-6-methylbenzenesulfonamide |
| SMILES | Cc1cccc(N)c1S(=O)(=O)NCC(C)(O)CO |
| InChI | InChI=1S/C11H18N2O4S/c1-8-4-3-5-9(12)10(8)18(16,17)13-6-11(2,15)7-14/h3-5,13-15H,6-7,12H2,1-2H3 |
| InChIKey | BZXKKCRBXQOSOF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|