C11H17FN2O4S — CID 66168567
5-amino-N-(2,3-dihydroxy-2-methylpropyl)-2-fluoro-4-methylbenzenesulfonamide (PubChem CID 66168567) has the molecular formula C11H17FN2O4S and a molecular weight of 292.33 g/mol. Its IUPAC name is 5-amino-N-(2,3-dihydroxy-2-methylpropyl)-2-fluoro-4-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2,3-dihydroxy-2-methylpropyl)-2-fluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66168567 |
| Molecular Formula | C11H17FN2O4S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-amino-N-(2,3-dihydroxy-2-methylpropyl)-2-fluoro-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(S(=O)(=O)NCC(C)(O)CO)cc1N |
| InChI | InChI=1S/C11H17FN2O4S/c1-7-3-8(12)10(4-9(7)13)19(17,18)14-5-11(2,16)6-15/h3-4,14-16H,5-6,13H2,1-2H3 |
| InChIKey | JCZQVRFIEJOKRX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|