C9H10BrF3N2O3S — CID 106165837
5-amino-2-bromo-N-(2,2-difluoro-3-hydroxypropyl)-4-fluorobenzenesulfonamide (PubChem CID 106165837) has the molecular formula C9H10BrF3N2O3S and a molecular weight of 363.16 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(2,2-difluoro-3-hydroxypropyl)-4-fluorobenzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(2,2-difluoro-3-hydroxypropyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106165837 |
| Molecular Formula | C9H10BrF3N2O3S |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 5-amino-2-bromo-N-(2,2-difluoro-3-hydroxypropyl)-4-fluorobenzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCC(F)(F)CO)c(Br)cc1F |
| InChI | InChI=1S/C9H10BrF3N2O3S/c10-5-1-6(11)7(14)2-8(5)19(17,18)15-3-9(12,13)4-16/h1-2,15-16H,3-4,14H2 |
| InChIKey | OUNQSNKNDZBVCV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|