C8H7ClF4N2O2S — CID 61111152
5-amino-2-chloro-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61111152) has the molecular formula C8H7ClF4N2O2S and a molecular weight of 306.67 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61111152 |
| Molecular Formula | C8H7ClF4N2O2S |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCC(F)(F)F)c(Cl)cc1F |
| InChI | InChI=1S/C8H7ClF4N2O2S/c9-4-1-5(10)6(14)2-7(4)18(16,17)15-3-8(11,12)13/h1-2,15H,3,14H2 |
| InChIKey | SVKYLONCRGYPBH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|