C11H17ClFN3O2S — CID 61127828
5-amino-2-chloro-N-[2-(dimethylamino)propyl]-4-fluorobenzenesulfonamide (PubChem CID 61127828) has the molecular formula C11H17ClFN3O2S and a molecular weight of 309.79 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[2-(dimethylamino)propyl]-4-fluorobenzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-[2-(dimethylamino)propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61127828 |
| Molecular Formula | C11H17ClFN3O2S |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-amino-2-chloro-N-[2-(dimethylamino)propyl]-4-fluorobenzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(N)c(F)cc1Cl)N(C)C |
| InChI | InChI=1S/C11H17ClFN3O2S/c1-7(16(2)3)6-15-19(17,18)11-5-10(14)9(13)4-8(11)12/h4-5,7,15H,6,14H2,1-3H3 |
| InChIKey | VDVAVUHQMRSTNJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|