C9H9ClF4N2O2S2 — CID 106425795
5-amino-2-chloro-4-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106425795) has the molecular formula C9H9ClF4N2O2S2 and a molecular weight of 352.76 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106425795 |
| Molecular Formula | C9H9ClF4N2O2S2 |
| Molecular Weight | 352.76 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCSC(F)(F)F)c(Cl)cc1F |
| InChI | InChI=1S/C9H9ClF4N2O2S2/c10-5-3-6(11)7(15)4-8(5)20(17,18)16-1-2-19-9(12,13)14/h3-4,16H,1-2,15H2 |
| InChIKey | VWJGVJVFJZQSHM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|