C9H12ClFN2O3S2 — CID 113479655
5-amino-2-chloro-4-fluoro-N-(2-methylsulfinylethyl)benzenesulfonamide (PubChem CID 113479655) has the molecular formula C9H12ClFN2O3S2 and a molecular weight of 314.79 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-(2-methylsulfinylethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-(2-methylsulfinylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113479655 |
| Molecular Formula | C9H12ClFN2O3S2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-(2-methylsulfinylethyl)benzenesulfonamide |
| SMILES | CS(=O)CCNS(=O)(=O)c1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C9H12ClFN2O3S2/c1-17(14)3-2-13-18(15,16)9-5-8(12)7(11)4-6(9)10/h4-5,13H,2-3,12H2,1H3 |
| InChIKey | JEMJDYYDTFNVAO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|