C12H18ClFN2O3S — CID 82949557
5-amino-2-chloro-4-fluoro-N-(3-propoxypropyl)benzenesulfonamide (PubChem CID 82949557) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-(3-propoxypropyl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-(3-propoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82949557 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-(3-propoxypropyl)benzenesulfonamide |
| SMILES | CCCOCCCNS(=O)(=O)c1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C12H18ClFN2O3S/c1-2-5-19-6-3-4-16-20(17,18)12-8-11(15)10(14)7-9(12)13/h7-8,16H,2-6,15H2,1H3 |
| InChIKey | IFQYOVJCDSDRJR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|