C11H16ClFN2O2S — CID 61165880
5-amino-2-chloro-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide (PubChem CID 61165880) has the molecular formula C11H16ClFN2O2S and a molecular weight of 294.78 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61165880 |
| Molecular Formula | C11H16ClFN2O2S |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-amino-2-chloro-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)CNS(=O)(=O)c1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C11H16ClFN2O2S/c1-11(2,3)6-15-18(16,17)10-5-9(14)8(13)4-7(10)12/h4-5,15H,6,14H2,1-3H3 |
| InChIKey | BKMLZCDRDOILSD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|