C8H7Cl2F3N2O2S2 — CID 113239619
5,6-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide (PubChem CID 113239619) has the molecular formula C8H7Cl2F3N2O2S2 and a molecular weight of 355.19 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113239619 |
| Molecular Formula | C8H7Cl2F3N2O2S2 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 5,6-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCSC(F)(F)F)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2F3N2O2S2/c9-6-3-5(4-14-7(6)10)19(16,17)15-1-2-18-8(11,12)13/h3-4,15H,1-2H2 |
| InChIKey | KFNOKGHXIBLPBM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|