C8H10F3N3O2S2 — CID 114187255
6-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide (PubChem CID 114187255) has the molecular formula C8H10F3N3O2S2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 6-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114187255 |
| Molecular Formula | C8H10F3N3O2S2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 6-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCCSC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H10F3N3O2S2/c9-8(10,11)17-4-3-14-18(15,16)6-1-2-7(12)13-5-6/h1-2,5,14H,3-4H2,(H2,12,13) |
| InChIKey | PYOPBMRAQBIXDR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|