C8H13N3O2S2 — CID 63963985
6-amino-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide (PubChem CID 63963985) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 6-amino-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63963985 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 6-amino-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
| SMILES | CSCCNS(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-14-5-4-11-15(12,13)7-2-3-8(9)10-6-7/h2-3,6,11H,4-5H2,1H3,(H2,9,10) |
| InChIKey | UYXJJBNJCXZWJR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|