C9H8BrClF3NO2S2 — CID 106432524
3-bromo-4-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106432524) has the molecular formula C9H8BrClF3NO2S2 and a molecular weight of 398.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106432524 |
| Molecular Formula | C9H8BrClF3NO2S2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 396.88 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSC(F)(F)F)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C9H8BrClF3NO2S2/c10-7-5-6(1-2-8(7)11)19(16,17)15-3-4-18-9(12,13)14/h1-2,5,15H,3-4H2 |
| InChIKey | MVTIXRBJVJDHPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|