C13H13ClF6N2O3S2 — CID 112842777
3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide (PubChem CID 112842777) has the molecular formula C13H13ClF6N2O3S2 and a molecular weight of 458.83 g/mol. Its IUPAC name is 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide.
| Compound Name | 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 112842777 |
| Molecular Formula | C13H13ClF6N2O3S2 |
| Molecular Weight | 458.83 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)NCCSC(F)(F)F |
| InChI | InChI=1S/C13H13ClF6N2O3S2/c14-10-2-1-8(7-9(10)12(15,16)17)27(24,25)22-4-3-11(23)21-5-6-26-13(18,19)20/h1-2,7,22H,3-6H2,(H,21,23) |
| InChIKey | QYHZVOYZXOIJGC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|