C13H16ClF3N2O4S — CID 51147527
3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 51147527) has the molecular formula C13H16ClF3N2O4S and a molecular weight of 388.80 g/mol. Its IUPAC name is 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 51147527 |
| Molecular Formula | C13H16ClF3N2O4S |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3N2O4S/c1-23-7-6-18-12(20)4-5-19-24(21,22)9-2-3-11(14)10(8-9)13(15,16)17/h2-3,8,19H,4-7H2,1H3,(H,18,20) |
| InChIKey | PORXZZZAMSAYPT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|