C14H18ClF3N2O3S — CID 78777743
N-tert-butyl-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 78777743) has the molecular formula C14H18ClF3N2O3S and a molecular weight of 386.82 g/mol. Its IUPAC name is N-tert-butyl-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-tert-butyl-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 78777743 |
| Molecular Formula | C14H18ClF3N2O3S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-tert-butyl-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2O3S/c1-13(2,3)20-12(21)6-7-19-24(22,23)9-4-5-11(15)10(8-9)14(16,17)18/h4-5,8,19H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | NPKQYXUAVKFOHX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |