C9H11F3N2O2S2 — CID 75406437
4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 75406437) has the molecular formula C9H11F3N2O2S2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75406437 |
| Molecular Formula | C9H11F3N2O2S2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCCSC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H11F3N2O2S2/c10-9(11,12)17-6-5-14-18(15,16)8-3-1-7(13)2-4-8/h1-4,14H,5-6,13H2 |
| InChIKey | HQQLYVCIGTYROU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|