C11H16F3N3O2S2 — CID 106432842
6-(propylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide (PubChem CID 106432842) has the molecular formula C11H16F3N3O2S2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 6-(propylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-(propylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106432842 |
| Molecular Formula | C11H16F3N3O2S2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 6-(propylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-sulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)NCCSC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N3O2S2/c1-2-5-15-10-4-3-9(8-16-10)21(18,19)17-6-7-20-11(12,13)14/h3-4,8,17H,2,5-7H2,1H3,(H,15,16) |
| InChIKey | ZHNXRFMGPGXMBZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|