C11H16F3N3O2S — CID 115522012
6-(ethylamino)-N-(4,4,4-trifluorobutyl)pyridine-3-sulfonamide (PubChem CID 115522012) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-(ethylamino)-N-(4,4,4-trifluorobutyl)pyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-(4,4,4-trifluorobutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115522012 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 6-(ethylamino)-N-(4,4,4-trifluorobutyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N3O2S/c1-2-15-10-5-4-9(8-16-10)20(18,19)17-7-3-6-11(12,13)14/h4-5,8,17H,2-3,6-7H2,1H3,(H,15,16) |
| InChIKey | GCADDEBHMAYQCB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|