C10H11F4NO4S2 — CID 114958441
4-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride (PubChem CID 114958441) has the molecular formula C10H11F4NO4S2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride.
| Compound Name | 4-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958441 |
| Molecular Formula | C10H11F4NO4S2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 4-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(S(=O)(=O)NCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F4NO4S2/c11-10(12,13)6-1-7-15-21(18,19)9-4-2-8(3-5-9)20(14,16)17/h2-5,15H,1,6-7H2 |
| InChIKey | RHONBALORFSCDP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|