3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride

C10H11F4NO4S2 — CID 114958442

IUPAC3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride
SMILESO=S(=O)(F)c1cccc(S(=O)(=O)NCCCC(F)(F)F)c1
InChIInChI=1S/C10H11F4NO4S2/c11-10(12,13)5-2-6-15-21(18,19)9-4-1-3-8(7-9)20(14,16)17/h1,3-4,7,15H,2,5-6H2
InChIKeyGZNDSPVDSOPZEI-UHFFFAOYSA-N
MW349.33 g/mol
LogP1.97
Rot. Bonds6

About 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride

3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride (PubChem CID 114958442) has the molecular formula C10H11F4NO4S2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride.

Molecular Properties

Compound Name3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride
PubChem CID114958442
Molecular FormulaC10H11F4NO4S2
Molecular Weight349.33 g/mol
Exact Mass349.01
IUPAC Name3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride
SMILESO=S(=O)(F)c1cccc(S(=O)(=O)NCCCC(F)(F)F)c1
InChIInChI=1S/C10H11F4NO4S2/c11-10(12,13)5-2-6-15-21(18,19)9-4-1-3-8(7-9)20(14,16)17/h1,3-4,7,15H,2,5-6H2
InChIKeyGZNDSPVDSOPZEI-UHFFFAOYSA-N
XLogP1.97
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.33
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride?
The IUPAC name of 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride (CID 114958442) is 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride.
What is the SMILES notation for 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride?
The canonical SMILES for 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride is O=S(=O)(F)c1cccc(S(=O)(=O)NCCCC(F)(F)F)c1.
What is the InChIKey of 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride?
The InChIKey is GZNDSPVDSOPZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F4NO4S2/c11-10(12,13)5-2-6-15-21(18,19)9-4-1-3-8(7-9)20(14,16)17/h1,3-4,7,15H,2,5-6H2.
What are the key properties of 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride?
3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride has a molecular weight of 349.33 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4,4-trifluorobutylsulfamoyl)benzenesulfonyl fluoride is sourced from PubChem (CID 114958442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).