C12H18FNO4S2 — CID 114958375
3-(2,3-dimethylbutylsulfamoyl)benzenesulfonyl fluoride (PubChem CID 114958375) has the molecular formula C12H18FNO4S2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-(2,3-dimethylbutylsulfamoyl)benzenesulfonyl fluoride.
| Compound Name | 3-(2,3-dimethylbutylsulfamoyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958375 |
| Molecular Formula | C12H18FNO4S2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-(2,3-dimethylbutylsulfamoyl)benzenesulfonyl fluoride |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C12H18FNO4S2/c1-9(2)10(3)8-14-20(17,18)12-6-4-5-11(7-12)19(13,15)16/h4-7,9-10,14H,8H2,1-3H3 |
| InChIKey | GRJCUBFNQUILOJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |