C15H21NO3S — CID 64598282
N-(2,3-dimethylbutyl)-3-(3-hydroxyprop-1-ynyl)benzenesulfonamide (PubChem CID 64598282) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-3-(3-hydroxyprop-1-ynyl)benzenesulfonamide.
| Compound Name | N-(2,3-dimethylbutyl)-3-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64598282 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(2,3-dimethylbutyl)-3-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C15H21NO3S/c1-12(2)13(3)11-16-20(18,19)15-8-4-6-14(10-15)7-5-9-17/h4,6,8,10,12-13,16-17H,9,11H2,1-3H3 |
| InChIKey | YCPRZGDYFXQLJA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|