C12H15N3O4S — CID 83115510
2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]ethylurea (PubChem CID 83115510) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]ethylurea.
| Compound Name | 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83115510 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C12H15N3O4S/c13-12(17)14-6-7-15-20(18,19)11-5-1-3-10(9-11)4-2-8-16/h1,3,5,9,15-16H,6-8H2,(H3,13,14,17) |
| InChIKey | OIAZZVFGTHXRBT-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|