C10H16N4O3S — CID 83116227
2-[[3-(aminomethyl)phenyl]sulfonylamino]ethylurea (PubChem CID 83116227) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)phenyl]sulfonylamino]ethylurea.
| Compound Name | 2-[[3-(aminomethyl)phenyl]sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83116227 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[[3-(aminomethyl)phenyl]sulfonylamino]ethylurea |
| SMILES | NCc1cccc(S(=O)(=O)NCCNC(N)=O)c1 |
| InChI | InChI=1S/C10H16N4O3S/c11-7-8-2-1-3-9(6-8)18(16,17)14-5-4-13-10(12)15/h1-3,6,14H,4-5,7,11H2,(H3,12,13,15) |
| InChIKey | FZMDCXJVRLBVKE-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|