C15H19ClN2O2S — CID 64570321
2-chloro-N-(2,3-dimethylbutyl)quinoline-6-sulfonamide (PubChem CID 64570321) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dimethylbutyl)quinoline-6-sulfonamide.
| Compound Name | 2-chloro-N-(2,3-dimethylbutyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 64570321 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-chloro-N-(2,3-dimethylbutyl)quinoline-6-sulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C15H19ClN2O2S/c1-10(2)11(3)9-17-21(19,20)13-5-6-14-12(8-13)4-7-15(16)18-14/h4-8,10-11,17H,9H2,1-3H3 |
| InChIKey | ZFKXDNLVAYLLQM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|