C13H14ClN3O3S — CID 60864854
4-[(2-chloroquinolin-6-yl)sulfonylamino]butanamide (PubChem CID 60864854) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 4-[(2-chloroquinolin-6-yl)sulfonylamino]butanamide.
| Compound Name | 4-[(2-chloroquinolin-6-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 60864854 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-[(2-chloroquinolin-6-yl)sulfonylamino]butanamide |
| SMILES | NC(=O)CCCNS(=O)(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C13H14ClN3O3S/c14-12-6-3-9-8-10(4-5-11(9)17-12)21(19,20)16-7-1-2-13(15)18/h3-6,8,16H,1-2,7H2,(H2,15,18) |
| InChIKey | LSJAOCGISDNBRN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|