C9H11Cl2N3O3S — CID 64608732
4-[(5,6-dichloro-3-pyridinyl)sulfonylamino]butanamide (PubChem CID 64608732) has the molecular formula C9H11Cl2N3O3S and a molecular weight of 312.18 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonylamino]butanamide.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 64608732 |
| Molecular Formula | C9H11Cl2N3O3S |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonylamino]butanamide |
| SMILES | NC(=O)CCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2N3O3S/c10-7-4-6(5-13-9(7)11)18(16,17)14-3-1-2-8(12)15/h4-5,14H,1-3H2,(H2,12,15) |
| InChIKey | LEQUJCIXEUIVGV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|