C11H15Cl2N3O3S — CID 64608415
3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide (PubChem CID 64608415) has the molecular formula C11H15Cl2N3O3S and a molecular weight of 340.23 g/mol. Its IUPAC name is 3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 64608415 |
| Molecular Formula | C11H15Cl2N3O3S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3O3S/c1-2-4-14-10(17)3-5-16-20(18,19)8-6-9(12)11(13)15-7-8/h6-7,16H,2-5H2,1H3,(H,14,17) |
| InChIKey | ONRWWLUJAOOKAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|